C26H44O2Si — CID 11811791
(1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1b,2,3,6,7,7a,8,9-octahydro-1H-cyclopropa[a]phenanthrene-4-carbaldehyde (PubChem CID 11811791) has the molecular formula C26H44O2Si and a molecular weight of 416.72 g/mol. Its IUPAC name is (1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1b,2,3,6,7,7a,8,9-octahydro-1H-cyclopropa[a]phenanthrene-4-carbaldehyde.
| Compound Name | (1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1b,2,3,6,7,7a,8,9-octahydro-1H-cyclopropa[a]phenanthrene-4-carbaldehyde |
|---|---|
| PubChem CID | 11811791 |
| Molecular Formula | C26H44O2Si |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1b,2,3,6,7,7a,8,9-octahydro-1H-cyclopropa[a]phenanthrene-4-carbaldehyde |
| SMILES | CC1=C(C=O)[C@]2(C)CC[C@@H]3[C@](C)(CC[C@@]4(O[Si](C)(C)C(C)(C)C)C[C@@]34C)[C@H]2CC1 |
| InChI | InChI=1S/C26H44O2Si/c1-18-10-11-20-23(5,19(18)16-27)13-12-21-24(20,6)14-15-26(17-25(21,26)7)28-29(8,9)22(2,3)4/h16,20-21H,10-15,17H2,1-9H3/t20-,21+,23-,24+,25-,26+/m0/s1 |
| InChIKey | GJHGXSONFPORAL-HCWFNAMGSA-N |
| XLogP | 7.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|