C13H17ClO2 — CID 118151847
(2R,3R)-2-(butoxymethyl)-3-(2-chlorophenyl)oxirane (PubChem CID 118151847) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is (2R,3R)-2-(butoxymethyl)-3-(2-chlorophenyl)oxirane.
| Compound Name | (2R,3R)-2-(butoxymethyl)-3-(2-chlorophenyl)oxirane |
|---|---|
| PubChem CID | 118151847 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (2R,3R)-2-(butoxymethyl)-3-(2-chlorophenyl)oxirane |
| SMILES | CCCCOC[C@H]1O[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C13H17ClO2/c1-2-3-8-15-9-12-13(16-12)10-6-4-5-7-11(10)14/h4-7,12-13H,2-3,8-9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | JOHJSNGDUHNVAS-CHWSQXEVSA-N |
| XLogP | 3.60 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|