C5H7BrO2 — CID 118161286
5-bromopent-4-yne-1,2-diol (PubChem CID 118161286) has the molecular formula C5H7BrO2 and a molecular weight of 179.01 g/mol. Its IUPAC name is 5-bromopent-4-yne-1,2-diol.
| Compound Name | 5-bromopent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 118161286 |
| Molecular Formula | C5H7BrO2 |
| Molecular Weight | 179.01 g/mol |
| Exact Mass | 177.96 |
| IUPAC Name | 5-bromopent-4-yne-1,2-diol |
| SMILES | OCC(O)CC#CBr |
| InChI | InChI=1S/C5H7BrO2/c6-3-1-2-5(8)4-7/h5,7-8H,2,4H2 |
| InChIKey | SAIDVIMJCSIHSF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.01 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|