About 5-bromopent-4-yne-1,2-diol
5-bromopent-4-yne-1,2-diol (PubChem CID 118161286) has the molecular formula C5H7BrO2
and a molecular weight of 179.01 g/mol. Its IUPAC name is 5-bromopent-4-yne-1,2-diol.
Molecular Properties
| Compound Name | 5-bromopent-4-yne-1,2-diol |
| PubChem CID | 118161286 |
| Molecular Formula | C5H7BrO2 |
| Molecular Weight | 179.01 g/mol |
| Exact Mass | 177.96 |
| IUPAC Name | 5-bromopent-4-yne-1,2-diol |
| SMILES | OCC(O)CC#CBr |
| InChI | InChI=1S/C5H7BrO2/c6-3-1-2-5(8)4-7/h5,7-8H,2,4H2 |
| InChIKey | SAIDVIMJCSIHSF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.01 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopent-4-yne-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopent-4-yne-1,2-diol?
The IUPAC name of 5-bromopent-4-yne-1,2-diol (CID 118161286) is 5-bromopent-4-yne-1,2-diol.
What is the SMILES notation for 5-bromopent-4-yne-1,2-diol?
The canonical SMILES for 5-bromopent-4-yne-1,2-diol is OCC(O)CC#CBr.
What is the InChIKey of 5-bromopent-4-yne-1,2-diol?
The InChIKey is SAIDVIMJCSIHSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrO2/c6-3-1-2-5(8)4-7/h5,7-8H,2,4H2.
What are the key properties of 5-bromopent-4-yne-1,2-diol?
5-bromopent-4-yne-1,2-diol has a molecular weight of 179.01 g/mol, XLogP of 0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopent-4-yne-1,2-diol is sourced from PubChem (CID 118161286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).