C19H10Br2F6N2O4S2 — CID 118163233
N-(2,5-dibromo-3-pyridinyl)-3-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]sulfonylbenzenesulfonamide (PubChem CID 118163233) has the molecular formula C19H10Br2F6N2O4S2 and a molecular weight of 668.23 g/mol. Its IUPAC name is N-(2,5-dibromo-3-pyridinyl)-3-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]sulfonylbenzenesulfonamide.
| Compound Name | N-(2,5-dibromo-3-pyridinyl)-3-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 118163233 |
| Molecular Formula | C19H10Br2F6N2O4S2 |
| Molecular Weight | 668.23 g/mol |
| Exact Mass | 665.84 |
| IUPAC Name | N-(2,5-dibromo-3-pyridinyl)-3-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]sulfonylbenzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N(c1cc(Br)cnc1Br)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H10Br2F6N2O4S2/c20-13-9-16(17(21)28-10-13)29(34(30,31)14-5-1-3-11(7-14)18(22,23)24)35(32,33)15-6-2-4-12(8-15)19(25,26)27/h1-10H |
| InChIKey | JGLKNUZWPVWJBS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.23 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|