C13H28NO4P — CID 118200063
[6-[2-(dimethylamino)ethoxy]-5,5-dimethylhept-6-en-3-yl]phosphonic acid (PubChem CID 118200063) has the molecular formula C13H28NO4P and a molecular weight of 293.34 g/mol. Its IUPAC name is [6-[2-(dimethylamino)ethoxy]-5,5-dimethylhept-6-en-3-yl]phosphonic acid.
| Compound Name | [6-[2-(dimethylamino)ethoxy]-5,5-dimethylhept-6-en-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 118200063 |
| Molecular Formula | C13H28NO4P |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | [6-[2-(dimethylamino)ethoxy]-5,5-dimethylhept-6-en-3-yl]phosphonic acid |
| SMILES | C=C(OCCN(C)C)C(C)(C)CC(CC)P(=O)(O)O |
| InChI | InChI=1S/C13H28NO4P/c1-7-12(19(15,16)17)10-13(3,4)11(2)18-9-8-14(5)6/h12H,2,7-10H2,1,3-6H3,(H2,15,16,17) |
| InChIKey | SJWBZLXGVICDFI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|