C23H47N2O2+ — CID 58875575
2-[7-[2-(dimethylamino)ethoxy]-6-ethyl-3,3,6-trimethylocta-1,7-dien-2-yl]oxyethyl-ethyl-dimethylazanium (PubChem CID 58875575) has the molecular formula C23H47N2O2+ and a molecular weight of 383.64 g/mol. Its IUPAC name is 2-[7-[2-(dimethylamino)ethoxy]-6-ethyl-3,3,6-trimethylocta-1,7-dien-2-yl]oxyethyl-ethyl-dimethylazanium.
| Compound Name | 2-[7-[2-(dimethylamino)ethoxy]-6-ethyl-3,3,6-trimethylocta-1,7-dien-2-yl]oxyethyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 58875575 |
| Molecular Formula | C23H47N2O2+ |
| Molecular Weight | 383.64 g/mol |
| Exact Mass | 383.36 |
| IUPAC Name | 2-[7-[2-(dimethylamino)ethoxy]-6-ethyl-3,3,6-trimethylocta-1,7-dien-2-yl]oxyethyl-ethyl-dimethylazanium |
| SMILES | C=C(OCC[N+](C)(C)CC)C(C)(C)CCC(C)(CC)C(=C)OCCN(C)C |
| InChI | InChI=1S/C23H47N2O2/c1-12-23(7,21(4)26-18-16-24(8)9)15-14-22(5,6)20(3)27-19-17-25(10,11)13-2/h3-4,12-19H2,1-2,5-11H3/q+1 |
| InChIKey | MCNLOHPBJLQYBF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|