C26H39NO9 — CID 118203160
(7-hydroxy-4-methoxy-2,2-dimethyl-6-propan-2-yloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 118203160) has the molecular formula C26H39NO9 and a molecular weight of 509.60 g/mol. Its IUPAC name is (7-hydroxy-4-methoxy-2,2-dimethyl-6-propan-2-yloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (7-hydroxy-4-methoxy-2,2-dimethyl-6-propan-2-yloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 118203160 |
| Molecular Formula | C26H39NO9 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (7-hydroxy-4-methoxy-2,2-dimethyl-6-propan-2-yloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC1C(OC(=O)[C@@H](NC(=O)OCc2ccccc2)C(C)C)C(OC(C)C)C(O)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C26H39NO9/c1-14(2)17(27-25(30)32-13-16-11-9-8-10-12-16)24(29)34-22-19(33-15(3)4)18(28)20-23(21(22)31-7)36-26(5,6)35-20/h8-12,14-15,17-23,28H,13H2,1-7H3,(H,27,30)/t17-,18?,19?,20?,21?,22?,23?/m0/s1 |
| InChIKey | SUWBWFFMRPTDAP-KISQMMJJSA-N |
| XLogP | 2.55 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |