C26H39NO11 — CID 118203275
[3-(2,2-dimethylpropanoyloxymethoxy)-2,4,5-trihydroxy-6-methoxycyclohexyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 118203275) has the molecular formula C26H39NO11 and a molecular weight of 541.59 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoyloxymethoxy)-2,4,5-trihydroxy-6-methoxycyclohexyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [3-(2,2-dimethylpropanoyloxymethoxy)-2,4,5-trihydroxy-6-methoxycyclohexyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 118203275 |
| Molecular Formula | C26H39NO11 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | [3-(2,2-dimethylpropanoyloxymethoxy)-2,4,5-trihydroxy-6-methoxycyclohexyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC1C(O)C(O)C(OCOC(=O)C(C)(C)C)C(O)C1OC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C26H39NO11/c1-14(2)16(27-25(33)35-12-15-10-8-7-9-11-15)23(31)38-22-19(30)20(17(28)18(29)21(22)34-6)36-13-37-24(32)26(3,4)5/h7-11,14,16-22,28-30H,12-13H2,1-6H3,(H,27,33)/t16-,17?,18?,19?,20?,21?,22?/m0/s1 |
| InChIKey | WDOVKASGSNWBDU-LAAAKRMBSA-N |
| XLogP | 0.89 |
| TPSA | 170.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|