C28H23F9O3S — CID 118220987
1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene (PubChem CID 118220987) has the molecular formula C28H23F9O3S and a molecular weight of 610.54 g/mol. Its IUPAC name is 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene.
| Compound Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene |
|---|---|
| PubChem CID | 118220987 |
| Molecular Formula | C28H23F9O3S |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylbenzene |
| SMILES | Cc1ccc(F)c(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)c1F |
| InChI | InChI=1S/C28H23F9O3S/c1-17-4-13-23(30)22(24(17)31)16-40-26(27(32,33)34,28(35,36)37)19-7-5-18(6-8-19)25(14-2-3-15-25)41(38,39)21-11-9-20(29)10-12-21/h4-13H,2-3,14-16H2,1H3 |
| InChIKey | VTVRFDSRMGEXAS-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |