C15H15P — CID 118221152
3,4,5-trimethylbenzo[b]phosphindole (PubChem CID 118221152) has the molecular formula C15H15P and a molecular weight of 226.26 g/mol. Its IUPAC name is 3,4,5-trimethylbenzo[b]phosphindole.
| Compound Name | 3,4,5-trimethylbenzo[b]phosphindole |
|---|---|
| PubChem CID | 118221152 |
| Molecular Formula | C15H15P |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3,4,5-trimethylbenzo[b]phosphindole |
| SMILES | Cc1ccc2c3ccccc3p(C)c2c1C |
| InChI | InChI=1S/C15H15P/c1-10-8-9-13-12-6-4-5-7-14(12)16(3)15(13)11(10)2/h4-9H,1-3H3 |
| InChIKey | HINDCQOBXJILIR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |