C18H18ClN5 — CID 118233271
7-chloro-15-(1,2,3-triazabicyclo[1.1.0]butan-4-ylmethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine (PubChem CID 118233271) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is 7-chloro-15-(1,2,3-triazabicyclo[1.1.0]butan-4-ylmethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine.
| Compound Name | 7-chloro-15-(1,2,3-triazabicyclo[1.1.0]butan-4-ylmethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 118233271 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 7-chloro-15-(1,2,3-triazabicyclo[1.1.0]butan-4-ylmethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
| SMILES | Nc1c2c(nc3cc(Cl)ccc13)CC1C=C(CC3n4[nH]n43)CC2C1 |
| InChI | InChI=1S/C18H18ClN5/c19-12-1-2-13-14(8-12)21-15-6-9-3-10(7-16-23-22-24(16)23)5-11(4-9)17(15)18(13)20/h1-3,8-9,11,16,22H,4-7H2,(H2,20,21) |
| InChIKey | HNHZXTNXTFFDQA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|