C36H40ClN6+ — CID 158181527
7-chloro-15-[4-[4-[2-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)ethyl]-2H-triazol-1-ium-1-yl]butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine (PubChem CID 158181527) has the molecular formula C36H40ClN6+ and a molecular weight of 592.21 g/mol. Its IUPAC name is 7-chloro-15-[4-[4-[2-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)ethyl]-2H-triazol-1-ium-1-yl]butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine.
| Compound Name | 7-chloro-15-[4-[4-[2-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)ethyl]-2H-triazol-1-ium-1-yl]butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 158181527 |
| Molecular Formula | C36H40ClN6+ |
| Molecular Weight | 592.21 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | 7-chloro-15-[4-[4-[2-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)ethyl]-2H-triazol-1-ium-1-yl]butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
| SMILES | Nc1c2c(nc3cc(Cl)ccc13)CC1C=C(CCCC[n+]3cc(CCC4CCc5c([nH]c6ccccc56)C4)n[nH]3)CC2C1 |
| InChI | InChI=1S/C36H39ClN6/c37-26-10-13-30-33(20-26)40-34-19-24-15-23(16-25(17-24)35(34)36(30)38)5-3-4-14-43-21-27(41-42-43)11-8-22-9-12-29-28-6-1-2-7-31(28)39-32(29)18-22/h1-2,6-7,10,13,15,20-22,24-25,39H,3-5,8-9,11-12,14,16-19H2,(H2,38,40)/p+1 |
| InChIKey | GWTUFXSXZVWUQC-UHFFFAOYSA-O |
| XLogP | 7.55 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.21 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|