C25H28ClN5 — CID 89397918
7-chloro-15-[4-(4-prop-1-en-2-yltriazol-1-yl)butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine (PubChem CID 89397918) has the molecular formula C25H28ClN5 and a molecular weight of 433.99 g/mol. Its IUPAC name is 7-chloro-15-[4-(4-prop-1-en-2-yltriazol-1-yl)butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine.
| Compound Name | 7-chloro-15-[4-(4-prop-1-en-2-yltriazol-1-yl)butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 89397918 |
| Molecular Formula | C25H28ClN5 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 7-chloro-15-[4-(4-prop-1-en-2-yltriazol-1-yl)butyl]-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
| SMILES | C=C(C)c1cn(CCCCC2=CC3Cc4nc5cc(Cl)ccc5c(N)c4C(C2)C3)nn1 |
| InChI | InChI=1S/C25H28ClN5/c1-15(2)23-14-31(30-29-23)8-4-3-5-16-9-17-11-18(10-16)24-22(12-17)28-21-13-19(26)6-7-20(21)25(24)27/h6-7,9,13-14,17-18H,1,3-5,8,10-12H2,2H3,(H2,27,28) |
| InChIKey | JIUOTSJLXODCAQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|