C20H19ClF3N3O3 — CID 53491566
2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 53491566) has the molecular formula C20H19ClF3N3O3 and a molecular weight of 441.84 g/mol. Its IUPAC name is 2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53491566 |
| Molecular Formula | C20H19ClF3N3O3 |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)CC1=CC2Cc3nc4cc(Cl)ccc4c(N)c3C(C1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18ClN3O.C2HF3O2/c19-12-1-2-13-14(8-12)22-15-6-9-3-10(7-16(20)23)5-11(4-9)17(15)18(13)21;3-2(4,5)1(6)7/h1-3,8-9,11H,4-7H2,(H2,20,23)(H2,21,22);(H,6,7) |
| InChIKey | BNKKBYFUHCMFHG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|