C24H26ClN5O2 — CID 71527363
methyl 1-[4-[(1R,13R)-3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl]butyl]triazole-4-carboxylate (PubChem CID 71527363) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is methyl 1-[4-[(1R,13R)-3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl]butyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[4-[(1R,13R)-3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl]butyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 71527363 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | methyl 1-[4-[(1R,13R)-3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl]butyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CCCCC2=C[C@H]3Cc4nc5cc(Cl)ccc5c(N)c4[C@@H](C2)C3)nn1 |
| InChI | InChI=1S/C24H26ClN5O2/c1-32-24(31)21-13-30(29-28-21)7-3-2-4-14-8-15-10-16(9-14)22-20(11-15)27-19-12-17(25)5-6-18(19)23(22)26/h5-6,8,12-13,15-16H,2-4,7,9-11H2,1H3,(H2,26,27)/t15-,16+/m1/s1 |
| InChIKey | PRLCYWWGJOBZSD-CVEARBPZSA-N |
| XLogP | 4.70 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|