C29H26N4O3 — CID 118234423
(3S)-3-[4-[[6-[4-(2-cyanopropan-2-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 118234423) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is (3S)-3-[4-[[6-[4-(2-cyanopropan-2-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[6-[4-(2-cyanopropan-2-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 118234423 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (3S)-3-[4-[[6-[4-(2-cyanopropan-2-yl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2cc(-c3ccc(C(C)(C)C#N)cc3)cn3ncnc23)cc1 |
| InChI | InChI=1S/C29H26N4O3/c1-4-5-22(15-27(34)35)20-8-12-26(13-9-20)36-17-24-14-23(16-33-28(24)31-19-32-33)21-6-10-25(11-7-21)29(2,3)18-30/h6-14,16,19,22H,15,17H2,1-3H3,(H,34,35)/t22-/m0/s1 |
| InChIKey | XKWSEKQRVZJDOW-QFIPXVFZSA-N |
| XLogP | 5.36 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|