C32H35N3O4S — CID 131968888
ethyl 3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate (PubChem CID 131968888) has the molecular formula C32H35N3O4S and a molecular weight of 557.72 g/mol. Its IUPAC name is ethyl 3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | ethyl 3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 131968888 |
| Molecular Formula | C32H35N3O4S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | ethyl 3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#CC(CC(=O)OCC)c1ccc(OCc2cc(-c3ccc(OCCCSC)cc3C)cn3ncnc23)cc1 |
| InChI | InChI=1S/C32H35N3O4S/c1-5-8-25(19-31(36)37-6-2)24-9-11-28(12-10-24)39-21-27-18-26(20-35-32(27)33-22-34-35)30-14-13-29(17-23(30)3)38-15-7-16-40-4/h9-14,17-18,20,22,25H,6-7,15-16,19,21H2,1-4H3 |
| InChIKey | CLMXBUIJJKXFFI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|