C30H31N3O4S — CID 131968973
(3S)-3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 131968973) has the molecular formula C30H31N3O4S and a molecular weight of 529.66 g/mol. Its IUPAC name is (3S)-3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 131968973 |
| Molecular Formula | C30H31N3O4S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | (3S)-3-[4-[[6-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2cc(-c3ccc(OCCCSC)cc3C)cn3ncnc23)cc1 |
| InChI | InChI=1S/C30H31N3O4S/c1-4-6-23(17-29(34)35)22-7-9-26(10-8-22)37-19-25-16-24(18-33-30(25)31-20-32-33)28-12-11-27(15-21(28)2)36-13-5-14-38-3/h7-12,15-16,18,20,23H,5,13-14,17,19H2,1-3H3,(H,34,35)/t23-/m0/s1 |
| InChIKey | NFDBMLFYLLCBPJ-QHCPKHFHSA-N |
| XLogP | 6.00 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|