C20H36O4Si — CID 11824776
methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,4-trimethyl-3-prop-2-enylcyclohex-3-ene-1-carboxylate (PubChem CID 11824776) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,4-trimethyl-3-prop-2-enylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,4-trimethyl-3-prop-2-enylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11824776 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | methyl (1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2,2,4-trimethyl-3-prop-2-enylcyclohex-3-ene-1-carboxylate |
| SMILES | C=CCC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@](O)(C(=O)OC)C1(C)C |
| InChI | InChI=1S/C20H36O4Si/c1-11-12-15-14(2)16(24-25(9,10)18(3,4)5)13-20(22,17(21)23-8)19(15,6)7/h11,16,22H,1,12-13H2,2-10H3/t16-,20+/m0/s1 |
| InChIKey | OAHQWQLVGORNFL-OXJNMPFZSA-N |
| XLogP | 4.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|