C9H10N2OS — CID 118281432
7-nitroso-2,3,4,5-tetrahydro-1,4-benzothiazepine (PubChem CID 118281432) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 7-nitroso-2,3,4,5-tetrahydro-1,4-benzothiazepine.
| Compound Name | 7-nitroso-2,3,4,5-tetrahydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 118281432 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 7-nitroso-2,3,4,5-tetrahydro-1,4-benzothiazepine |
| SMILES | O=Nc1ccc2c(c1)CNCCS2 |
| InChI | InChI=1S/C9H10N2OS/c12-11-8-1-2-9-7(5-8)6-10-3-4-13-9/h1-2,5,10H,3-4,6H2 |
| InChIKey | QMUAHZDPONRPMC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |