C22H9F7O7S — CID 118284468
3-methyl-4-[2,4,5,7-tetrafluoro-3-oxo-6-(trifluoromethylsulfonyloxy)xanthen-9-yl]benzoic acid (PubChem CID 118284468) has the molecular formula C22H9F7O7S and a molecular weight of 550.36 g/mol. Its IUPAC name is 3-methyl-4-[2,4,5,7-tetrafluoro-3-oxo-6-(trifluoromethylsulfonyloxy)xanthen-9-yl]benzoic acid.
| Compound Name | 3-methyl-4-[2,4,5,7-tetrafluoro-3-oxo-6-(trifluoromethylsulfonyloxy)xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 118284468 |
| Molecular Formula | C22H9F7O7S |
| Molecular Weight | 550.36 g/mol |
| Exact Mass | 550.00 |
| IUPAC Name | 3-methyl-4-[2,4,5,7-tetrafluoro-3-oxo-6-(trifluoromethylsulfonyloxy)xanthen-9-yl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1c2cc(F)c(=O)c(F)c-2oc2c(F)c(OS(=O)(=O)C(F)(F)F)c(F)cc12 |
| InChI | InChI=1S/C22H9F7O7S/c1-7-4-8(21(31)32)2-3-9(7)14-10-5-12(23)17(30)15(25)18(10)35-19-11(14)6-13(24)20(16(19)26)36-37(33,34)22(27,28)29/h2-6H,1H3,(H,31,32) |
| InChIKey | WYRROWABNWBIRF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|