C22H9F7O6S — CID 118284491
(2',4',5',7'-tetrafluoro-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) trifluoromethanesulfonate (PubChem CID 118284491) has the molecular formula C22H9F7O6S and a molecular weight of 534.36 g/mol. Its IUPAC name is (2',4',5',7'-tetrafluoro-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) trifluoromethanesulfonate.
| Compound Name | (2',4',5',7'-tetrafluoro-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118284491 |
| Molecular Formula | C22H9F7O6S |
| Molecular Weight | 534.36 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | (2',4',5',7'-tetrafluoro-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) trifluoromethanesulfonate |
| SMILES | Cc1c(F)cc2c(c1F)Oc1c(cc(F)c(OS(=O)(=O)C(F)(F)F)c1F)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H9F7O6S/c1-8-13(23)6-11-17(15(8)25)33-18-12(21(11)10-5-3-2-4-9(10)20(30)34-21)7-14(24)19(16(18)26)35-36(31,32)22(27,28)29/h2-7H,1H3 |
| InChIKey | FKTBSNNCTSMOSJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|