C26H10F4N2O11S — CID 58640918
3'-(2,4-dinitrophenyl)peroxysulfanyloxy-2',4',5',7'-tetrafluoro-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 58640918) has the molecular formula C26H10F4N2O11S and a molecular weight of 634.43 g/mol. Its IUPAC name is 3'-(2,4-dinitrophenyl)peroxysulfanyloxy-2',4',5',7'-tetrafluoro-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-(2,4-dinitrophenyl)peroxysulfanyloxy-2',4',5',7'-tetrafluoro-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 58640918 |
| Molecular Formula | C26H10F4N2O11S |
| Molecular Weight | 634.43 g/mol |
| Exact Mass | 633.99 |
| IUPAC Name | 3'-(2,4-dinitrophenyl)peroxysulfanyloxy-2',4',5',7'-tetrafluoro-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccccc31)c1cc(F)c(O)c(F)c1Oc1c2cc(F)c(OSOOc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1F |
| InChI | InChI=1S/C26H10F4N2O11S/c27-15-8-13-22(19(29)21(15)33)39-23-14(26(13)12-4-2-1-3-11(12)25(34)40-26)9-16(28)24(20(23)30)42-44-43-41-18-6-5-10(31(35)36)7-17(18)32(37)38/h1-9,33H |
| InChIKey | UYXKCOPPCYKXJE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.43 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|