C47H67NO8 — CID 11828796
tert-butyl N-[(3S,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-15-[2-(3-phenylmethoxypropyl)-1,3-dioxolan-2-yl]pentadec-1-en-6-yl]carbamate (PubChem CID 11828796) has the molecular formula C47H67NO8 and a molecular weight of 774.05 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-15-[2-(3-phenylmethoxypropyl)-1,3-dioxolan-2-yl]pentadec-1-en-6-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-15-[2-(3-phenylmethoxypropyl)-1,3-dioxolan-2-yl]pentadec-1-en-6-yl]carbamate |
|---|---|
| PubChem CID | 11828796 |
| Molecular Formula | C47H67NO8 |
| Molecular Weight | 774.05 g/mol |
| Exact Mass | 773.49 |
| IUPAC Name | tert-butyl N-[(3S,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-15-[2-(3-phenylmethoxypropyl)-1,3-dioxolan-2-yl]pentadec-1-en-6-yl]carbamate |
| SMILES | C=C[C@H](O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](CCCCCCCCCC1(CCCOCc2ccccc2)OCCO1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C47H67NO8/c1-5-42(49)44(53-37-40-27-18-13-19-28-40)43(52-36-39-25-16-12-17-26-39)41(48-45(50)56-46(2,3)4)29-20-9-7-6-8-10-21-30-47(54-33-34-55-47)31-22-32-51-35-38-23-14-11-15-24-38/h5,11-19,23-28,41-44,49H,1,6-10,20-22,29-37H2,2-4H3,(H,48,50)/t41-,42+,43-,44-/m1/s1 |
| InChIKey | YHZUJQOXKMTUIE-GHZPUDFRSA-N |
| XLogP | 9.85 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.05 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|