C12H22O5 — CID 11831714
(2R,3S,4R,5S,6S)-2-(1-hydroxycyclohexyl)-6-methyloxane-3,4,5-triol (PubChem CID 11831714) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-2-(1-hydroxycyclohexyl)-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6S)-2-(1-hydroxycyclohexyl)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 11831714 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-(1-hydroxycyclohexyl)-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](C2(O)CCCCC2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22O5/c1-7-8(13)9(14)10(15)11(17-7)12(16)5-3-2-4-6-12/h7-11,13-16H,2-6H2,1H3/t7-,8+,9+,10-,11+/m0/s1 |
| InChIKey | DOPXNNOBSARDQT-UNQZSWDGSA-N |
| XLogP | -0.45 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |