C27H24N2O2 — CID 118358593
(1,2-dimethylindol-3-yl) 2-(1,2-dimethylindol-3-yl)benzoate (PubChem CID 118358593) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is (1,2-dimethylindol-3-yl) 2-(1,2-dimethylindol-3-yl)benzoate.
| Compound Name | (1,2-dimethylindol-3-yl) 2-(1,2-dimethylindol-3-yl)benzoate |
|---|---|
| PubChem CID | 118358593 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (1,2-dimethylindol-3-yl) 2-(1,2-dimethylindol-3-yl)benzoate |
| SMILES | Cc1c(OC(=O)c2ccccc2-c2c(C)n(C)c3ccccc23)c2ccccc2n1C |
| InChI | InChI=1S/C27H24N2O2/c1-17-25(21-13-7-9-15-23(21)28(17)3)19-11-5-6-12-20(19)27(30)31-26-18(2)29(4)24-16-10-8-14-22(24)26/h5-16H,1-4H3 |
| InChIKey | AROQNDZGOYDENV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |