C18H17NO3S — CID 118368384
(3aS,4R,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide (PubChem CID 118368384) has the molecular formula C18H17NO3S and a molecular weight of 327.40 g/mol. Its IUPAC name is (3aS,4R,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide.
| Compound Name | (3aS,4R,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide |
|---|---|
| PubChem CID | 118368384 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (3aS,4R,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide |
| SMILES | O=S1O[C@H]2[C@H](n3c4ccccc4c4ccccc43)CCC[C@H]2O1 |
| InChI | InChI=1S/C18H17NO3S/c20-23-21-17-11-5-10-16(18(17)22-23)19-14-8-3-1-6-12(14)13-7-2-4-9-15(13)19/h1-4,6-9,16-18H,5,10-11H2/t16-,17-,18+,23?/m1/s1 |
| InChIKey | KBHZSJSGOQTRPI-PSLLWMRSSA-N |
| XLogP | 3.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |