C18H18BrNO3S — CID 126674425
(3aS,4R,7aR)-N-(4-bromophenyl)-2-oxo-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiol-4-amine (PubChem CID 126674425) has the molecular formula C18H18BrNO3S and a molecular weight of 408.32 g/mol. Its IUPAC name is (3aS,4R,7aR)-N-(4-bromophenyl)-2-oxo-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiol-4-amine.
| Compound Name | (3aS,4R,7aR)-N-(4-bromophenyl)-2-oxo-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiol-4-amine |
|---|---|
| PubChem CID | 126674425 |
| Molecular Formula | C18H18BrNO3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (3aS,4R,7aR)-N-(4-bromophenyl)-2-oxo-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiol-4-amine |
| SMILES | O=S1O[C@H]2[C@H](N(c3ccccc3)c3ccc(Br)cc3)CCC[C@H]2O1 |
| InChI | InChI=1S/C18H18BrNO3S/c19-13-9-11-15(12-10-13)20(14-5-2-1-3-6-14)16-7-4-8-17-18(16)23-24(21)22-17/h1-3,5-6,9-12,16-18H,4,7-8H2/t16-,17-,18+,24?/m1/s1 |
| InChIKey | OPZRPHBXLNRFKX-NGEMFATLSA-N |
| XLogP | 4.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |