C9H4Cl2N2O3S — CID 11837169
2-(3,5-dichlorophenoxy)-5-nitro-1,3-thiazole (PubChem CID 11837169) has the molecular formula C9H4Cl2N2O3S and a molecular weight of 291.12 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-5-nitro-1,3-thiazole.
| Compound Name | 2-(3,5-dichlorophenoxy)-5-nitro-1,3-thiazole |
|---|---|
| PubChem CID | 11837169 |
| Molecular Formula | C9H4Cl2N2O3S |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-5-nitro-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cnc(Oc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C9H4Cl2N2O3S/c10-5-1-6(11)3-7(2-5)16-9-12-4-8(17-9)13(14)15/h1-4H |
| InChIKey | CLGHNPHIWANVBO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|