C17H32O — CID 118398122
(1E,5E)-2,4,5,8,8-pentamethyl-1-propoxynona-1,5-diene (PubChem CID 118398122) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is (1E,5E)-2,4,5,8,8-pentamethyl-1-propoxynona-1,5-diene.
| Compound Name | (1E,5E)-2,4,5,8,8-pentamethyl-1-propoxynona-1,5-diene |
|---|---|
| PubChem CID | 118398122 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (1E,5E)-2,4,5,8,8-pentamethyl-1-propoxynona-1,5-diene |
| SMILES | CCCO/C=C(\C)CC(C)/C(C)=C/CC(C)(C)C |
| InChI | InChI=1S/C17H32O/c1-8-11-18-13-14(2)12-16(4)15(3)9-10-17(5,6)7/h9,13,16H,8,10-12H2,1-7H3/b14-13+,15-9+ |
| InChIKey | FHLBOODLQVEMQK-FYXBLBNSSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|