C18H19N3O2S — CID 118422062
5-[[4-(propan-2-ylsulfanylamino)phenyl]methylamino]isoindole-1,3-dione (PubChem CID 118422062) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 5-[[4-(propan-2-ylsulfanylamino)phenyl]methylamino]isoindole-1,3-dione.
| Compound Name | 5-[[4-(propan-2-ylsulfanylamino)phenyl]methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118422062 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-[[4-(propan-2-ylsulfanylamino)phenyl]methylamino]isoindole-1,3-dione |
| SMILES | CC(C)SNc1ccc(CNc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-11(2)24-21-13-5-3-12(4-6-13)10-19-14-7-8-15-16(9-14)18(23)20-17(15)22/h3-9,11,19,21H,10H2,1-2H3,(H,20,22,23) |
| InChIKey | ZYDZJIFFSDHNQZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|