C30H32Cl3NO8 — CID 118437540
2,2,2-trichloroethyl 2-[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-methylbut-3-en-2-yloxy)-4-oxobutyl]-1,3-dioxolane-4-carboxylate (PubChem CID 118437540) has the molecular formula C30H32Cl3NO8 and a molecular weight of 640.94 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-methylbut-3-en-2-yloxy)-4-oxobutyl]-1,3-dioxolane-4-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 2-[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-methylbut-3-en-2-yloxy)-4-oxobutyl]-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 118437540 |
| Molecular Formula | C30H32Cl3NO8 |
| Molecular Weight | 640.94 g/mol |
| Exact Mass | 639.12 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-methylbut-3-en-2-yloxy)-4-oxobutyl]-1,3-dioxolane-4-carboxylate |
| SMILES | C=CC(C)(C)OC(=O)[C@H](CCC1OCC(C(=O)OCC(Cl)(Cl)Cl)O1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H32Cl3NO8/c1-4-29(2,3)42-26(35)23(13-14-25-38-16-24(41-25)27(36)40-17-30(31,32)33)34-28(37)39-15-22-20-11-7-5-9-18(20)19-10-6-8-12-21(19)22/h4-12,22-25H,1,13-17H2,2-3H3,(H,34,37)/t23-,24?,25?/m0/s1 |
| InChIKey | ZVSIHUCOSMLGCS-KAVZGVEFSA-N |
| XLogP | 5.84 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.94 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|