C17H28N3O7P — CID 118476569
2-amino-4-[3-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butanoic acid (PubChem CID 118476569) has the molecular formula C17H28N3O7P and a molecular weight of 417.40 g/mol. Its IUPAC name is 2-amino-4-[3-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butanoic acid.
| Compound Name | 2-amino-4-[3-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 118476569 |
| Molecular Formula | C17H28N3O7P |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-amino-4-[3-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butanoic acid |
| SMILES | C=P(C)(C)CC[C@H]1O[C@@H](n2ccc(=O)n(CCC(N)C(=O)O)c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H28N3O7P/c1-28(2,3)9-6-11-13(22)14(23)15(27-11)20-8-5-12(21)19(17(20)26)7-4-10(18)16(24)25/h5,8,10-11,13-15,22-23H,1,4,6-7,9,18H2,2-3H3,(H,24,25)/t10?,11-,13-,14-,15-/m1/s1 |
| InChIKey | CZAGSFXNNDOJPG-BPWKVOTDSA-N |
| XLogP | -1.47 |
| TPSA | 157.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|