C20H37NO — CID 118520931
(7R,11R)-3,7,11,15-tetramethyl-3-nitrosohexadec-1-yne (PubChem CID 118520931) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is (7R,11R)-3,7,11,15-tetramethyl-3-nitrosohexadec-1-yne.
| Compound Name | (7R,11R)-3,7,11,15-tetramethyl-3-nitrosohexadec-1-yne |
|---|---|
| PubChem CID | 118520931 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (7R,11R)-3,7,11,15-tetramethyl-3-nitrosohexadec-1-yne |
| SMILES | C#CC(C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)N=O |
| InChI | InChI=1S/C20H37NO/c1-7-20(6,21-22)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h1,17-19H,8-16H2,2-6H3/t18-,19-,20?/m1/s1 |
| InChIKey | KKUKBVWXCKFMBP-LEAGNCFPSA-N |
| XLogP | 6.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|