C9H9NO4S2 — CID 118563832
4-(1,3-dithiolan-2-yl)-5-nitrobenzene-1,2-diol (PubChem CID 118563832) has the molecular formula C9H9NO4S2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-5-nitrobenzene-1,2-diol.
| Compound Name | 4-(1,3-dithiolan-2-yl)-5-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 118563832 |
| Molecular Formula | C9H9NO4S2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-5-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(O)c(O)cc1C1SCCS1 |
| InChI | InChI=1S/C9H9NO4S2/c11-7-3-5(9-15-1-2-16-9)6(10(13)14)4-8(7)12/h3-4,9,11-12H,1-2H2 |
| InChIKey | XFENDZFXTAOCGH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|