C19H15N7 — CID 118573001
N-[(1-pyridin-2-ylindolizin-2-yl)methyl]-7H-purin-6-amine (PubChem CID 118573001) has the molecular formula C19H15N7 and a molecular weight of 341.38 g/mol. Its IUPAC name is N-[(1-pyridin-2-ylindolizin-2-yl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(1-pyridin-2-ylindolizin-2-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 118573001 |
| Molecular Formula | C19H15N7 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[(1-pyridin-2-ylindolizin-2-yl)methyl]-7H-purin-6-amine |
| SMILES | c1ccc(-c2c(CNc3ncnc4nc[nH]c34)cn3ccccc23)nc1 |
| InChI | InChI=1S/C19H15N7/c1-3-7-20-14(5-1)16-13(10-26-8-4-2-6-15(16)26)9-21-18-17-19(23-11-22-17)25-12-24-18/h1-8,10-12H,9H2,(H2,21,22,23,24,25) |
| InChIKey | DWSKLBXLASTSJQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |