3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride

C15H9F5O — CID 118604572

IUPAC3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride
SMILESO=C(F)c1ccc(CCc2cc(F)c(F)c(F)c2)c(F)c1
InChIInChI=1S/C15H9F5O/c16-11-7-10(15(20)21)4-3-9(11)2-1-8-5-12(17)14(19)13(18)6-8/h3-7H,1-2H2
InChIKeyOBVOXFDTNHQOQO-UHFFFAOYSA-N
MW300.23 g/mol
LogP4.14
Rot. Bonds4

About 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride

3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride (PubChem CID 118604572) has the molecular formula C15H9F5O and a molecular weight of 300.23 g/mol. Its IUPAC name is 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride.

Molecular Properties

Compound Name3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride
PubChem CID118604572
Molecular FormulaC15H9F5O
Molecular Weight300.23 g/mol
Exact Mass300.06
IUPAC Name3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride
SMILESO=C(F)c1ccc(CCc2cc(F)c(F)c(F)c2)c(F)c1
InChIInChI=1S/C15H9F5O/c16-11-7-10(15(20)21)4-3-9(11)2-1-8-5-12(17)14(19)13(18)6-8/h3-7H,1-2H2
InChIKeyOBVOXFDTNHQOQO-UHFFFAOYSA-N
XLogP4.14
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.23
LogP ≤ 54.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride?
The IUPAC name of 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride (CID 118604572) is 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride.
What is the SMILES notation for 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride?
The canonical SMILES for 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride is O=C(F)c1ccc(CCc2cc(F)c(F)c(F)c2)c(F)c1.
What is the InChIKey of 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride?
The InChIKey is OBVOXFDTNHQOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F5O/c16-11-7-10(15(20)21)4-3-9(11)2-1-8-5-12(17)14(19)13(18)6-8/h3-7H,1-2H2.
What are the key properties of 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride?
3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride has a molecular weight of 300.23 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]benzoyl fluoride is sourced from PubChem (CID 118604572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).