C44H29FO8 — CID 118605700
2-[4-[2-[2-(buta-1,3-dien-2-yloxymethoxy)-3-fluoro-6-prop-2-enoyloxy-4-[4-[4-(2-prop-2-enoyloxyethynyl)phenyl]phenyl]phenyl]ethynyl]phenyl]ethynyl prop-2-enoate (PubChem CID 118605700) has the molecular formula C44H29FO8 and a molecular weight of 704.71 g/mol. Its IUPAC name is 2-[4-[2-[2-(buta-1,3-dien-2-yloxymethoxy)-3-fluoro-6-prop-2-enoyloxy-4-[4-[4-(2-prop-2-enoyloxyethynyl)phenyl]phenyl]phenyl]ethynyl]phenyl]ethynyl prop-2-enoate.
| Compound Name | 2-[4-[2-[2-(buta-1,3-dien-2-yloxymethoxy)-3-fluoro-6-prop-2-enoyloxy-4-[4-[4-(2-prop-2-enoyloxyethynyl)phenyl]phenyl]phenyl]ethynyl]phenyl]ethynyl prop-2-enoate |
|---|---|
| PubChem CID | 118605700 |
| Molecular Formula | C44H29FO8 |
| Molecular Weight | 704.71 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | 2-[4-[2-[2-(buta-1,3-dien-2-yloxymethoxy)-3-fluoro-6-prop-2-enoyloxy-4-[4-[4-(2-prop-2-enoyloxyethynyl)phenyl]phenyl]phenyl]ethynyl]phenyl]ethynyl prop-2-enoate |
| SMILES | C=CC(=C)OCOc1c(F)c(-c2ccc(-c3ccc(C#COC(=O)C=C)cc3)cc2)cc(OC(=O)C=C)c1C#Cc1ccc(C#COC(=O)C=C)cc1 |
| InChI | InChI=1S/C44H29FO8/c1-6-30(5)51-29-52-44-37(23-16-31-10-12-32(13-11-31)24-26-49-40(46)7-2)39(53-42(48)9-4)28-38(43(44)45)36-21-19-35(20-22-36)34-17-14-33(15-18-34)25-27-50-41(47)8-3/h6-15,17-22,28H,1-5,29H2 |
| InChIKey | OYXGZUXADVXPBV-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.71 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|