C9H7F4N5O2S — CID 118619927
(2R)-2-[2-(4-azido-2,3,5,6-tetrafluorophenyl)hydrazinyl]-3-sulfanylpropanoic acid (PubChem CID 118619927) has the molecular formula C9H7F4N5O2S and a molecular weight of 325.25 g/mol. Its IUPAC name is (2R)-2-[2-(4-azido-2,3,5,6-tetrafluorophenyl)hydrazinyl]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[2-(4-azido-2,3,5,6-tetrafluorophenyl)hydrazinyl]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 118619927 |
| Molecular Formula | C9H7F4N5O2S |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (2R)-2-[2-(4-azido-2,3,5,6-tetrafluorophenyl)hydrazinyl]-3-sulfanylpropanoic acid |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(NN[C@@H](CS)C(=O)O)c(F)c1F |
| InChI | InChI=1S/C9H7F4N5O2S/c10-3-5(12)8(17-18-14)6(13)4(11)7(3)16-15-2(1-21)9(19)20/h2,15-16,21H,1H2,(H,19,20)/t2-/m0/s1 |
| InChIKey | TXOXRDLJCHJREQ-REOHCLBHSA-N |
| XLogP | 2.48 |
| TPSA | 110.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|