C18H12ClN3OS — CID 118642006
N-(6-chloro-4-phenoxy-2-pyridinyl)-1,3-benzothiazol-2-amine (PubChem CID 118642006) has the molecular formula C18H12ClN3OS and a molecular weight of 353.83 g/mol. Its IUPAC name is N-(6-chloro-4-phenoxy-2-pyridinyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(6-chloro-4-phenoxy-2-pyridinyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 118642006 |
| Molecular Formula | C18H12ClN3OS |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-(6-chloro-4-phenoxy-2-pyridinyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1cc(Oc2ccccc2)cc(Nc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C18H12ClN3OS/c19-16-10-13(23-12-6-2-1-3-7-12)11-17(21-16)22-18-20-14-8-4-5-9-15(14)24-18/h1-11H,(H,20,21,22) |
| InChIKey | HSZORLMALBKQTO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|