C14H13N2O2PS — CID 71395207
N-[methyl(phenoxy)phosphoryl]-1,3-benzothiazol-2-amine (PubChem CID 71395207) has the molecular formula C14H13N2O2PS and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[methyl(phenoxy)phosphoryl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[methyl(phenoxy)phosphoryl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 71395207 |
| Molecular Formula | C14H13N2O2PS |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-[methyl(phenoxy)phosphoryl]-1,3-benzothiazol-2-amine |
| SMILES | CP(=O)(Nc1nc2ccccc2s1)Oc1ccccc1 |
| InChI | InChI=1S/C14H13N2O2PS/c1-19(17,18-11-7-3-2-4-8-11)16-14-15-12-9-5-6-10-13(12)20-14/h2-10H,1H3,(H,15,16,17) |
| InChIKey | XSZAMQBNPQNNJR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|