C9H14N2O — CID 118643342
1-nitroso-2-azatricyclo[3.3.1.13,7]decane (PubChem CID 118643342) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-nitroso-2-azatricyclo[3.3.1.13,7]decane.
| Compound Name | 1-nitroso-2-azatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 118643342 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-nitroso-2-azatricyclo[3.3.1.13,7]decane |
| SMILES | O=NC12CC3CC(CC(C3)N1)C2 |
| InChI | InChI=1S/C9H14N2O/c12-11-9-4-6-1-7(5-9)3-8(2-6)10-9/h6-8,10H,1-5H2 |
| InChIKey | MSNLQUDFJPCVFH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |