C9H17Cl2IN2 — CID 87743947
N-iodo-2-azatricyclo[3.3.1.13,7]decan-1-amine;dihydrochloride (PubChem CID 87743947) has the molecular formula C9H17Cl2IN2 and a molecular weight of 351.06 g/mol. Its IUPAC name is N-iodo-2-azatricyclo[3.3.1.13,7]decan-1-amine;dihydrochloride.
| Compound Name | N-iodo-2-azatricyclo[3.3.1.13,7]decan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 87743947 |
| Molecular Formula | C9H17Cl2IN2 |
| Molecular Weight | 351.06 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | N-iodo-2-azatricyclo[3.3.1.13,7]decan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.INC12CC3CC(CC(C3)N1)C2 |
| InChI | InChI=1S/C9H15IN2.2ClH/c10-12-9-4-6-1-7(5-9)3-8(2-6)11-9;;/h6-8,11-12H,1-5H2;2*1H |
| InChIKey | VCWJHNOUDRYNSW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.06 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|