C6H3F9O2 — CID 118644778
1-ethenylperoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane (PubChem CID 118644778) has the molecular formula C6H3F9O2 and a molecular weight of 278.07 g/mol. Its IUPAC name is 1-ethenylperoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane.
| Compound Name | 1-ethenylperoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 118644778 |
| Molecular Formula | C6H3F9O2 |
| Molecular Weight | 278.07 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1-ethenylperoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| SMILES | C=COOC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F9O2/c1-2-16-17-6(14,15)4(9,10)3(7,8)5(11,12)13/h2H,1H2 |
| InChIKey | NMJKYHXQKOIKMN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.07 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|