C9H7F4N5O2S — CID 118711627
4-[4-(aminomethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 118711627) has the molecular formula C9H7F4N5O2S and a molecular weight of 325.25 g/mol. Its IUPAC name is 4-[4-(aminomethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-[4-(aminomethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 118711627 |
| Molecular Formula | C9H7F4N5O2S |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 4-[4-(aminomethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NCc1cn(-c2c(F)c(F)c(S(N)(=O)=O)c(F)c2F)nn1 |
| InChI | InChI=1S/C9H7F4N5O2S/c10-4-6(12)9(21(15,19)20)7(13)5(11)8(4)18-2-3(1-14)16-17-18/h2H,1,14H2,(H2,15,19,20) |
| InChIKey | MYVKQDUAXMPPSE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|