C35H52N6O5 — CID 118724973
tert-butyl N-[N'-[5-[(4-anilino-1-benzylpiperidin-4-yl)methylamino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 118724973) has the molecular formula C35H52N6O5 and a molecular weight of 636.84 g/mol. Its IUPAC name is tert-butyl N-[N'-[5-[(4-anilino-1-benzylpiperidin-4-yl)methylamino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[5-[(4-anilino-1-benzylpiperidin-4-yl)methylamino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 118724973 |
| Molecular Formula | C35H52N6O5 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | tert-butyl N-[N'-[5-[(4-anilino-1-benzylpiperidin-4-yl)methylamino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCC(=O)NCC1(Nc2ccccc2)CCN(Cc2ccccc2)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H52N6O5/c1-33(2,3)45-31(43)38-30(39-32(44)46-34(4,5)6)36-22-14-13-19-29(42)37-26-35(40-28-17-11-8-12-18-28)20-23-41(24-21-35)25-27-15-9-7-10-16-27/h7-12,15-18,40H,13-14,19-26H2,1-6H3,(H,37,42)(H2,36,38,39,43,44) |
| InChIKey | AHHXHDPMFIEXGP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|