C36H30F3N5O4 — CID 118727331
(Z)-4-[5-[(3,5-difluorophenyl)methyl]-1-[(2-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]but-3-ene-1,2-dione (PubChem CID 118727331) has the molecular formula C36H30F3N5O4 and a molecular weight of 653.66 g/mol. Its IUPAC name is (Z)-4-[5-[(3,5-difluorophenyl)methyl]-1-[(2-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]but-3-ene-1,2-dione.
| Compound Name | (Z)-4-[5-[(3,5-difluorophenyl)methyl]-1-[(2-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]but-3-ene-1,2-dione |
|---|---|
| PubChem CID | 118727331 |
| Molecular Formula | C36H30F3N5O4 |
| Molecular Weight | 653.66 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | (Z)-4-[5-[(3,5-difluorophenyl)methyl]-1-[(2-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]but-3-ene-1,2-dione |
| SMILES | O=C(/C=C(\O)c1cc(Cc2cc(F)cc(F)c2)cn(Cc2ccccc2F)c1=O)C(=O)N1CCN(c2ccc(-n3ccnc3)cc2)CC1 |
| InChI | InChI=1S/C36H30F3N5O4/c37-27-16-24(17-28(38)19-27)15-25-18-31(35(47)44(21-25)22-26-3-1-2-4-32(26)39)33(45)20-34(46)36(48)42-13-11-41(12-14-42)29-5-7-30(8-6-29)43-10-9-40-23-43/h1-10,16-21,23,45H,11-15,22H2/b33-20- |
| InChIKey | UUNWOCDESWFYFI-UCMJSZAQSA-N |
| XLogP | 4.91 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|