C35H30F2N6O4 — CID 71761536
4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-1-[4-[4-(1,2,4-triazol-1-yl)phenyl]piperazin-1-yl]butane-1,2,4-trione (PubChem CID 71761536) has the molecular formula C35H30F2N6O4 and a molecular weight of 636.66 g/mol. Its IUPAC name is 4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-1-[4-[4-(1,2,4-triazol-1-yl)phenyl]piperazin-1-yl]butane-1,2,4-trione.
| Compound Name | 4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-1-[4-[4-(1,2,4-triazol-1-yl)phenyl]piperazin-1-yl]butane-1,2,4-trione |
|---|---|
| PubChem CID | 71761536 |
| Molecular Formula | C35H30F2N6O4 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-1-[4-[4-(1,2,4-triazol-1-yl)phenyl]piperazin-1-yl]butane-1,2,4-trione |
| SMILES | O=C(CC(=O)c1cc(Cc2ccc(F)cc2)cn(Cc2ccccc2F)c1=O)C(=O)N1CCN(c2ccc(-n3cncn3)cc2)CC1 |
| InChI | InChI=1S/C35H30F2N6O4/c36-27-7-5-24(6-8-27)17-25-18-30(34(46)42(20-25)21-26-3-1-2-4-31(26)37)32(44)19-33(45)35(47)41-15-13-40(14-16-41)28-9-11-29(12-10-28)43-23-38-22-39-43/h1-12,18,20,22-23H,13-17,19,21H2 |
| InChIKey | WEWMWGJBGSVYIE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 110.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|