C37H29F4N3O4 — CID 71761240
4-[1-[(4-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]-1-(4-naphthalen-1-ylpiperazin-1-yl)butane-1,2,4-trione (PubChem CID 71761240) has the molecular formula C37H29F4N3O4 and a molecular weight of 655.65 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]-1-(4-naphthalen-1-ylpiperazin-1-yl)butane-1,2,4-trione.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]-1-(4-naphthalen-1-ylpiperazin-1-yl)butane-1,2,4-trione |
|---|---|
| PubChem CID | 71761240 |
| Molecular Formula | C37H29F4N3O4 |
| Molecular Weight | 655.65 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]-1-(4-naphthalen-1-ylpiperazin-1-yl)butane-1,2,4-trione |
| SMILES | O=C(CC(=O)c1cc(Cc2c(F)cc(F)cc2F)cn(Cc2ccc(F)cc2)c1=O)C(=O)N1CCN(c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C37H29F4N3O4/c38-26-10-8-23(9-11-26)21-44-22-24(16-29-31(40)18-27(39)19-32(29)41)17-30(36(44)47)34(45)20-35(46)37(48)43-14-12-42(13-15-43)33-7-3-5-25-4-1-2-6-28(25)33/h1-11,17-19,22H,12-16,20-21H2 |
| InChIKey | DZZMFTALARWHQN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|