C36H34F4N4O4 — CID 123713893
1-[4-[4-[ethyl(methyl)amino]phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione (PubChem CID 123713893) has the molecular formula C36H34F4N4O4 and a molecular weight of 662.68 g/mol. Its IUPAC name is 1-[4-[4-[ethyl(methyl)amino]phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione.
| Compound Name | 1-[4-[4-[ethyl(methyl)amino]phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione |
|---|---|
| PubChem CID | 123713893 |
| Molecular Formula | C36H34F4N4O4 |
| Molecular Weight | 662.68 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 1-[4-[4-[ethyl(methyl)amino]phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione |
| SMILES | CCN(C)c1ccc(N2CCN(C(=O)C(=O)CC(=O)c3cc(Cc4c(F)cc(F)cc4F)cn(Cc4ccccc4F)c3=O)CC2)cc1 |
| InChI | InChI=1S/C36H34F4N4O4/c1-3-41(2)26-8-10-27(11-9-26)42-12-14-43(15-13-42)36(48)34(46)20-33(45)29-17-23(16-28-31(39)18-25(37)19-32(28)40)21-44(35(29)47)22-24-6-4-5-7-30(24)38/h4-11,17-19,21H,3,12-16,20,22H2,1-2H3 |
| InChIKey | NGSWYNWTWBRQIQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|